C31H40O7 — CID 88691683
tert-butyl benzenecarboperoxoate;dicyclohexyl benzene-1,2-dicarboxylate (PubChem CID 88691683) has the molecular formula C31H40O7 and a molecular weight of 524.65 g/mol. Its IUPAC name is tert-butyl benzenecarboperoxoate;dicyclohexyl benzene-1,2-dicarboxylate.
| Compound Name | tert-butyl benzenecarboperoxoate;dicyclohexyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 88691683 |
| Molecular Formula | C31H40O7 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | tert-butyl benzenecarboperoxoate;dicyclohexyl benzene-1,2-dicarboxylate |
| SMILES | CC(C)(C)OOC(=O)c1ccccc1.O=C(OC1CCCCC1)c1ccccc1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C20H26O4.C11H14O3/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16;1-11(2,3)14-13-10(12)9-7-5-4-6-8-9/h7-8,13-16H,1-6,9-12H2;4-8H,1-3H3 |
| InChIKey | FQYGDDIEJVPHJZ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|