About benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate
benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate (PubChem CID 87085937) has the molecular formula C18H20O6
and a molecular weight of 332.35 g/mol. Its IUPAC name is benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate.
Molecular Properties
| Compound Name | benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate |
| PubChem CID | 87085937 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate |
| SMILES | CC(C)(C)OOC(=O)c1ccccc1.O=C(OO)c1ccccc1 |
| InChI | InChI=1S/C11H14O3.C7H6O3/c1-11(2,3)14-13-10(12)9-7-5-4-6-8-9;8-7(10-9)6-4-2-1-3-5-6/h4-8H,1-3H3;1-5,9H |
| InChIKey | RSKFZGHMRUTWOS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate?
The IUPAC name of benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate (CID 87085937) is benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate.
What is the SMILES notation for benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate?
The canonical SMILES for benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate is CC(C)(C)OOC(=O)c1ccccc1.O=C(OO)c1ccccc1.
What is the InChIKey of benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate?
The InChIKey is RSKFZGHMRUTWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3.C7H6O3/c1-11(2,3)14-13-10(12)9-7-5-4-6-8-9;8-7(10-9)6-4-2-1-3-5-6/h4-8H,1-3H3;1-5,9H.
What are the key properties of benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate?
benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate has a molecular weight of 332.35 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarboperoxoic acid;tert-butyl benzenecarboperoxoate is sourced from PubChem (CID 87085937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).