C32H42O8 — CID 174814619
benzene;(5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;2-hydroperoxy-2-methylpropane (PubChem CID 174814619) has the molecular formula C32H42O8 and a molecular weight of 554.68 g/mol. Its IUPAC name is benzene;(5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;2-hydroperoxy-2-methylpropane.
| Compound Name | benzene;(5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;2-hydroperoxy-2-methylpropane |
|---|---|
| PubChem CID | 174814619 |
| Molecular Formula | C32H42O8 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | benzene;(5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;2-hydroperoxy-2-methylpropane |
| SMILES | CC(C)(C)OO.CC(C)(CCC(C)(C)OOC(=O)c1ccccc1)OOC(=O)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C22H26O6.C6H6.C4H10O2/c1-21(2,27-25-19(23)17-11-7-5-8-12-17)15-16-22(3,4)28-26-20(24)18-13-9-6-10-14-18;1-2-4-6-5-3-1;1-4(2,3)6-5/h5-14H,15-16H2,1-4H3;1-6H;5H,1-3H3 |
| InChIKey | GAJHXAQEORFQJJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|