About 3-ethylpentan-3-yl benzenecarboperoxoate
3-ethylpentan-3-yl benzenecarboperoxoate (PubChem CID 101304466) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-ethylpentan-3-yl benzenecarboperoxoate.
Molecular Properties
| Compound Name | 3-ethylpentan-3-yl benzenecarboperoxoate |
| PubChem CID | 101304466 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3-ethylpentan-3-yl benzenecarboperoxoate |
| SMILES | CCC(CC)(CC)OOC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-4-14(5-2,6-3)17-16-13(15)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChIKey | ONRBVXXFEQTHDW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpentan-3-yl benzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpentan-3-yl benzenecarboperoxoate?
The IUPAC name of 3-ethylpentan-3-yl benzenecarboperoxoate (CID 101304466) is 3-ethylpentan-3-yl benzenecarboperoxoate.
What is the SMILES notation for 3-ethylpentan-3-yl benzenecarboperoxoate?
The canonical SMILES for 3-ethylpentan-3-yl benzenecarboperoxoate is CCC(CC)(CC)OOC(=O)c1ccccc1.
What is the InChIKey of 3-ethylpentan-3-yl benzenecarboperoxoate?
The InChIKey is ONRBVXXFEQTHDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-4-14(5-2,6-3)17-16-13(15)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3.
What are the key properties of 3-ethylpentan-3-yl benzenecarboperoxoate?
3-ethylpentan-3-yl benzenecarboperoxoate has a molecular weight of 236.31 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpentan-3-yl benzenecarboperoxoate is sourced from PubChem (CID 101304466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).