C26H34O7 — CID 163527155
(5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;butan-2-one (PubChem CID 163527155) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is (5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;butan-2-one.
| Compound Name | (5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;butan-2-one |
|---|---|
| PubChem CID | 163527155 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;butan-2-one |
| SMILES | CC(C)(CCC(C)(C)OOC(=O)c1ccccc1)OOC(=O)c1ccccc1.CCC(C)=O |
| InChI | InChI=1S/C22H26O6.C4H8O/c1-21(2,27-25-19(23)17-11-7-5-8-12-17)15-16-22(3,4)28-26-20(24)18-13-9-6-10-14-18;1-3-4(2)5/h5-14H,15-16H2,1-4H3;3H2,1-2H3 |
| InChIKey | DPTLWGLITZNGJU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|