C22H26O6 — CID 18463334
(5-benzoylperoxy-2,5-dimethylhexyl) benzenecarboperoxoate (PubChem CID 18463334) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is (5-benzoylperoxy-2,5-dimethylhexyl) benzenecarboperoxoate.
| Compound Name | (5-benzoylperoxy-2,5-dimethylhexyl) benzenecarboperoxoate |
|---|---|
| PubChem CID | 18463334 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (5-benzoylperoxy-2,5-dimethylhexyl) benzenecarboperoxoate |
| SMILES | CC(CCC(C)(C)OOC(=O)c1ccccc1)COOC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26O6/c1-17(16-25-26-20(23)18-10-6-4-7-11-18)14-15-22(2,3)28-27-21(24)19-12-8-5-9-13-19/h4-13,17H,14-16H2,1-3H3 |
| InChIKey | BNWSYWRJSXSGHG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|