About benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane
benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane (PubChem CID 87385719) has the molecular formula C22H28O6
and a molecular weight of 388.46 g/mol. Its IUPAC name is benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane.
Molecular Properties
| Compound Name | benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane |
| PubChem CID | 87385719 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane |
| SMILES | CC(C)(C)OOC(C)(C)C.O=C(OOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O4.C8H18O2/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12;1-7(2,3)9-10-8(4,5)6/h1-10H;1-6H3 |
| InChIKey | HFUSECPXGUISGB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane?
The IUPAC name of benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane (CID 87385719) is benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane.
What is the SMILES notation for benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane?
The canonical SMILES for benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane is CC(C)(C)OOC(C)(C)C.O=C(OOC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane?
The InChIKey is HFUSECPXGUISGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4.C8H18O2/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12;1-7(2,3)9-10-8(4,5)6/h1-10H;1-6H3.
What are the key properties of benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane?
benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane has a molecular weight of 388.46 g/mol, XLogP of 5.15, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl benzenecarboperoxoate;2-tert-butylperoxy-2-methylpropane is sourced from PubChem (CID 87385719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).