C38H60O10 — CID 21188236
(5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;2,5-bis(tert-butylperoxy)-2,5-dimethylhexane (PubChem CID 21188236) has the molecular formula C38H60O10 and a molecular weight of 676.89 g/mol. Its IUPAC name is (5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;2,5-bis(tert-butylperoxy)-2,5-dimethylhexane.
| Compound Name | (5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;2,5-bis(tert-butylperoxy)-2,5-dimethylhexane |
|---|---|
| PubChem CID | 21188236 |
| Molecular Formula | C38H60O10 |
| Molecular Weight | 676.89 g/mol |
| Exact Mass | 676.42 |
| IUPAC Name | (5-benzoylperoxy-2,5-dimethylhexan-2-yl) benzenecarboperoxoate;2,5-bis(tert-butylperoxy)-2,5-dimethylhexane |
| SMILES | CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)C.CC(C)(CCC(C)(C)OOC(=O)c1ccccc1)OOC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26O6.C16H34O4/c1-21(2,27-25-19(23)17-11-7-5-8-12-17)15-16-22(3,4)28-26-20(24)18-13-9-6-10-14-18;1-13(2,3)17-19-15(7,8)11-12-16(9,10)20-18-14(4,5)6/h5-14H,15-16H2,1-4H3;11-12H2,1-10H3 |
| InChIKey | NKGMIMQFAWCCAE-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.89 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|