C27H46O9 — CID 90123365
tert-butyl benzenecarboperoxoate;ethyl 3,3-bis(2-methylbutan-2-ylperoxy)butanoate (PubChem CID 90123365) has the molecular formula C27H46O9 and a molecular weight of 514.66 g/mol. Its IUPAC name is tert-butyl benzenecarboperoxoate;ethyl 3,3-bis(2-methylbutan-2-ylperoxy)butanoate.
| Compound Name | tert-butyl benzenecarboperoxoate;ethyl 3,3-bis(2-methylbutan-2-ylperoxy)butanoate |
|---|---|
| PubChem CID | 90123365 |
| Molecular Formula | C27H46O9 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | tert-butyl benzenecarboperoxoate;ethyl 3,3-bis(2-methylbutan-2-ylperoxy)butanoate |
| SMILES | CC(C)(C)OOC(=O)c1ccccc1.CCOC(=O)CC(C)(OOC(C)(C)CC)OOC(C)(C)CC |
| InChI | InChI=1S/C16H32O6.C11H14O3/c1-9-14(4,5)19-21-16(8,12-13(17)18-11-3)22-20-15(6,7)10-2;1-11(2,3)14-13-10(12)9-7-5-4-6-8-9/h9-12H2,1-8H3;4-8H,1-3H3 |
| InChIKey | ZHLQIFAVTHCCAX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|