About butane;2-phenylpropan-2-yl benzenecarboperoxoate
butane;2-phenylpropan-2-yl benzenecarboperoxoate (PubChem CID 174772868) has the molecular formula C20H26O3
and a molecular weight of 314.42 g/mol. Its IUPAC name is butane;2-phenylpropan-2-yl benzenecarboperoxoate.
Molecular Properties
| Compound Name | butane;2-phenylpropan-2-yl benzenecarboperoxoate |
| PubChem CID | 174772868 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | butane;2-phenylpropan-2-yl benzenecarboperoxoate |
| SMILES | CC(C)(OOC(=O)c1ccccc1)c1ccccc1.CCCC |
| InChI | InChI=1S/C16H16O3.C4H10/c1-16(2,14-11-7-4-8-12-14)19-18-15(17)13-9-5-3-6-10-13;1-3-4-2/h3-12H,1-2H3;3-4H2,1-2H3 |
| InChIKey | UKQQJKQXWAFKDM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze butane;2-phenylpropan-2-yl benzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-phenylpropan-2-yl benzenecarboperoxoate?
The IUPAC name of butane;2-phenylpropan-2-yl benzenecarboperoxoate (CID 174772868) is butane;2-phenylpropan-2-yl benzenecarboperoxoate.
What is the SMILES notation for butane;2-phenylpropan-2-yl benzenecarboperoxoate?
The canonical SMILES for butane;2-phenylpropan-2-yl benzenecarboperoxoate is CC(C)(OOC(=O)c1ccccc1)c1ccccc1.CCCC.
What is the InChIKey of butane;2-phenylpropan-2-yl benzenecarboperoxoate?
The InChIKey is UKQQJKQXWAFKDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3.C4H10/c1-16(2,14-11-7-4-8-12-14)19-18-15(17)13-9-5-3-6-10-13;1-3-4-2/h3-12H,1-2H3;3-4H2,1-2H3.
What are the key properties of butane;2-phenylpropan-2-yl benzenecarboperoxoate?
butane;2-phenylpropan-2-yl benzenecarboperoxoate has a molecular weight of 314.42 g/mol, XLogP of 5.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-phenylpropan-2-yl benzenecarboperoxoate is sourced from PubChem (CID 174772868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).