C29H36O6 — CID 174533693
(2-methylpropan-2-yl)oxy benzenecarboperoxoate;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene (PubChem CID 174533693) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxy benzenecarboperoxoate;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene.
| Compound Name | (2-methylpropan-2-yl)oxy benzenecarboperoxoate;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene |
|---|---|
| PubChem CID | 174533693 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (2-methylpropan-2-yl)oxy benzenecarboperoxoate;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene |
| SMILES | CC(C)(C)OOOC(=O)c1ccccc1.CC(C)(OOC(C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22O2.C11H14O4/c1-17(2,15-11-7-5-8-12-15)19-20-18(3,4)16-13-9-6-10-14-16;1-11(2,3)14-15-13-10(12)9-7-5-4-6-8-9/h5-14H,1-4H3;4-8H,1-3H3 |
| InChIKey | UQZAPPMENJSARN-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|