C20H24O7 — CID 175134122
carboxy hydrogen carbonate;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene (PubChem CID 175134122) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is carboxy hydrogen carbonate;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene.
| Compound Name | carboxy hydrogen carbonate;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene |
|---|---|
| PubChem CID | 175134122 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | carboxy hydrogen carbonate;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene |
| SMILES | CC(C)(OOC(C)(C)c1ccccc1)c1ccccc1.O=C(O)OC(=O)O |
| InChI | InChI=1S/C18H22O2.C2H2O5/c1-17(2,15-11-7-5-8-12-15)19-20-18(3,4)16-13-9-6-10-14-16;3-1(4)7-2(5)6/h5-14H,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | MXPUKOLKNQQXBX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|