About dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene
dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene (PubChem CID 174507938) has the molecular formula C18H22Cl2O2Zn
and a molecular weight of 406.67 g/mol. Its IUPAC name is dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene.
Molecular Properties
| Compound Name | dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene |
| PubChem CID | 174507938 |
| Molecular Formula | C18H22Cl2O2Zn |
| Molecular Weight | 406.67 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene |
| SMILES | CC(C)(OOC(C)(C)c1ccccc1)c1ccccc1.Cl[Zn]Cl |
| InChI | InChI=1S/C18H22O2.2ClH.Zn/c1-17(2,15-11-7-5-8-12-15)19-20-18(3,4)16-13-9-6-10-14-16;;;/h5-14H,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | INMDQMKFXAIBPA-UHFFFAOYSA-L |
| XLogP | 6.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene?
The IUPAC name of dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene (CID 174507938) is dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene.
What is the SMILES notation for dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene?
The canonical SMILES for dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene is CC(C)(OOC(C)(C)c1ccccc1)c1ccccc1.Cl[Zn]Cl.
What is the InChIKey of dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene?
The InChIKey is INMDQMKFXAIBPA-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H22O2.2ClH.Zn/c1-17(2,15-11-7-5-8-12-15)19-20-18(3,4)16-13-9-6-10-14-16;;;/h5-14H,1-4H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene?
dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene has a molecular weight of 406.67 g/mol, XLogP of 6.18, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozinc;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene is sourced from PubChem (CID 174507938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).