C27H30O4 — CID 163671526
2,2-bis(2-phenylpropan-2-ylperoxy)-1,3-dihydroindene (PubChem CID 163671526) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is 2,2-bis(2-phenylpropan-2-ylperoxy)-1,3-dihydroindene.
| Compound Name | 2,2-bis(2-phenylpropan-2-ylperoxy)-1,3-dihydroindene |
|---|---|
| PubChem CID | 163671526 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 2,2-bis(2-phenylpropan-2-ylperoxy)-1,3-dihydroindene |
| SMILES | CC(C)(OOC1(OOC(C)(C)c2ccccc2)Cc2ccccc2C1)c1ccccc1 |
| InChI | InChI=1S/C27H30O4/c1-25(2,23-15-7-5-8-16-23)28-30-27(19-21-13-11-12-14-22(21)20-27)31-29-26(3,4)24-17-9-6-10-18-24/h5-18H,19-20H2,1-4H3 |
| InChIKey | JCZKFDWKZQWQES-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|