C19H30NO+ — CID 162782714
2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylhexan-1-one (PubChem CID 162782714) has the molecular formula C19H30NO+ and a molecular weight of 288.45 g/mol. Its IUPAC name is 2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylhexan-1-one.
| Compound Name | 2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylhexan-1-one |
|---|---|
| PubChem CID | 162782714 |
| Molecular Formula | C19H30NO+ |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-(1,1-dimethylpiperidin-1-ium-2-yl)-1-phenylhexan-1-one |
| SMILES | CCCCC(C(=O)c1ccccc1)C1CCCC[N+]1(C)C |
| InChI | InChI=1S/C19H30NO/c1-4-5-13-17(18-14-9-10-15-20(18,2)3)19(21)16-11-7-6-8-12-16/h6-8,11-12,17-18H,4-5,9-10,13-15H2,1-3H3/q+1 |
| InChIKey | GIFQZTZDYQGZMY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|