C22H24O3 — CID 142717062
2-butyl-1-phenyl-3-(4-prop-2-enoxyphenyl)propane-1,3-dione (PubChem CID 142717062) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-butyl-1-phenyl-3-(4-prop-2-enoxyphenyl)propane-1,3-dione.
| Compound Name | 2-butyl-1-phenyl-3-(4-prop-2-enoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 142717062 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-butyl-1-phenyl-3-(4-prop-2-enoxyphenyl)propane-1,3-dione |
| SMILES | C=CCOc1ccc(C(=O)C(CCCC)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24O3/c1-3-5-11-20(21(23)17-9-7-6-8-10-17)22(24)18-12-14-19(15-13-18)25-16-4-2/h4,6-10,12-15,20H,2-3,5,11,16H2,1H3 |
| InChIKey | FJCWLTWLXSTFMJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|