C19H18O4 — CID 129074944
1-(4-ethoxyphenyl)-2-(4-prop-2-enoxyphenyl)ethane-1,2-dione (PubChem CID 129074944) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-(4-prop-2-enoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-(4-ethoxyphenyl)-2-(4-prop-2-enoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 129074944 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-(4-prop-2-enoxyphenyl)ethane-1,2-dione |
| SMILES | C=CCOc1ccc(C(=O)C(=O)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C19H18O4/c1-3-13-23-17-11-7-15(8-12-17)19(21)18(20)14-5-9-16(10-6-14)22-4-2/h3,5-12H,1,4,13H2,2H3 |
| InChIKey | YDAKBCZMVFVEHJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|