C12H15NO3 — CID 60735511
N-ethoxy-4-prop-2-enoxybenzamide (PubChem CID 60735511) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-ethoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-ethoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 60735511 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-ethoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NOCC)cc1 |
| InChI | InChI=1S/C12H15NO3/c1-3-9-15-11-7-5-10(6-8-11)12(14)13-16-4-2/h3,5-8H,1,4,9H2,2H3,(H,13,14) |
| InChIKey | RENPEDVMIURNQB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|