C33H38O5 — CID 19810151
[1-oxo-1-(4-prop-2-enoxyphenyl)propan-2-yl] 4-(4-octoxyphenyl)benzoate (PubChem CID 19810151) has the molecular formula C33H38O5 and a molecular weight of 514.66 g/mol. Its IUPAC name is [1-oxo-1-(4-prop-2-enoxyphenyl)propan-2-yl] 4-(4-octoxyphenyl)benzoate.
| Compound Name | [1-oxo-1-(4-prop-2-enoxyphenyl)propan-2-yl] 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 19810151 |
| Molecular Formula | C33H38O5 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | [1-oxo-1-(4-prop-2-enoxyphenyl)propan-2-yl] 4-(4-octoxyphenyl)benzoate |
| SMILES | C=CCOc1ccc(C(=O)C(C)OC(=O)c2ccc(-c3ccc(OCCCCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H38O5/c1-4-6-7-8-9-10-24-37-31-19-15-27(16-20-31)26-11-13-29(14-12-26)33(35)38-25(3)32(34)28-17-21-30(22-18-28)36-23-5-2/h5,11-22,25H,2,4,6-10,23-24H2,1,3H3 |
| InChIKey | MCYAPAQDJZZXBT-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|