About (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate
(1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate (PubChem CID 55569795) has the molecular formula C19H18O4
and a molecular weight of 310.35 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate.
Molecular Properties
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate |
| PubChem CID | 55569795 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OC(C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18O4/c1-3-13-22-17-11-9-16(10-12-17)19(21)23-14(2)18(20)15-7-5-4-6-8-15/h3-12,14H,1,13H2,2H3 |
| InChIKey | REYAGPUPPWXRDG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate?
The IUPAC name of (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate (CID 55569795) is (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate.
What is the SMILES notation for (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate?
The canonical SMILES for (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate is C=CCOc1ccc(C(=O)OC(C)C(=O)c2ccccc2)cc1.
What is the InChIKey of (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate?
The InChIKey is REYAGPUPPWXRDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O4/c1-3-13-22-17-11-9-16(10-12-17)19(21)23-14(2)18(20)15-7-5-4-6-8-15/h3-12,14H,1,13H2,2H3.
What are the key properties of (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate?
(1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate has a molecular weight of 310.35 g/mol, XLogP of 3.68, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxo-1-phenylpropan-2-yl) 4-prop-2-enoxybenzoate is sourced from PubChem (CID 55569795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).