C35H42O6 — CID 19810040
[4-(2-pentanoyloxypropanoyl)phenyl] 4-(4-octoxyphenyl)benzoate (PubChem CID 19810040) has the molecular formula C35H42O6 and a molecular weight of 558.72 g/mol. Its IUPAC name is [4-(2-pentanoyloxypropanoyl)phenyl] 4-(4-octoxyphenyl)benzoate.
| Compound Name | [4-(2-pentanoyloxypropanoyl)phenyl] 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 19810040 |
| Molecular Formula | C35H42O6 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | [4-(2-pentanoyloxypropanoyl)phenyl] 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)C(C)OC(=O)CCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H42O6/c1-4-6-8-9-10-11-25-39-31-21-17-28(18-22-31)27-13-15-30(16-14-27)35(38)41-32-23-19-29(20-24-32)34(37)26(3)40-33(36)12-7-5-2/h13-24,26H,4-12,25H2,1-3H3 |
| InChIKey | ZRXWUWOIXXNLNV-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|