C27H46NO2+ — CID 98129648
benzyl-[(2R)-1-cyclohexyloxy-1-oxododecan-2-yl]-dimethylazanium (PubChem CID 98129648) has the molecular formula C27H46NO2+ and a molecular weight of 416.67 g/mol. Its IUPAC name is benzyl-[(2R)-1-cyclohexyloxy-1-oxododecan-2-yl]-dimethylazanium.
| Compound Name | benzyl-[(2R)-1-cyclohexyloxy-1-oxododecan-2-yl]-dimethylazanium |
|---|---|
| PubChem CID | 98129648 |
| Molecular Formula | C27H46NO2+ |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | benzyl-[(2R)-1-cyclohexyloxy-1-oxododecan-2-yl]-dimethylazanium |
| SMILES | CCCCCCCCCC[C@H](C(=O)OC1CCCCC1)[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C27H46NO2/c1-4-5-6-7-8-9-10-17-22-26(27(29)30-25-20-15-12-16-21-25)28(2,3)23-24-18-13-11-14-19-24/h11,13-14,18-19,25-26H,4-10,12,15-17,20-23H2,1-3H3/q+1/t26-/m1/s1 |
| InChIKey | BUUOLRNUSJDNKU-AREMUKBSSA-N |
| XLogP | 7.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|