C16H23NO2 — CID 155077226
cyclohexyl (2S)-2-(methylamino)-3-phenylpropanoate (PubChem CID 155077226) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is cyclohexyl (2S)-2-(methylamino)-3-phenylpropanoate.
| Compound Name | cyclohexyl (2S)-2-(methylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 155077226 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | cyclohexyl (2S)-2-(methylamino)-3-phenylpropanoate |
| SMILES | CN[C@@H](Cc1ccccc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C16H23NO2/c1-17-15(12-13-8-4-2-5-9-13)16(18)19-14-10-6-3-7-11-14/h2,4-5,8-9,14-15,17H,3,6-7,10-12H2,1H3/t15-/m0/s1 |
| InChIKey | XYAUQHLPSZKVOD-HNNXBMFYSA-N |
| XLogP | 2.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |