C23H27NO3S — CID 166358012
cyclopentyl (2S)-2-[[5-(cyclopropylmethyl)thiophene-2-carbonyl]amino]-3-phenylpropanoate (PubChem CID 166358012) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[5-(cyclopropylmethyl)thiophene-2-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | cyclopentyl (2S)-2-[[5-(cyclopropylmethyl)thiophene-2-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 166358012 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | cyclopentyl (2S)-2-[[5-(cyclopropylmethyl)thiophene-2-carbonyl]amino]-3-phenylpropanoate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)OC1CCCC1)c1ccc(CC2CC2)s1 |
| InChI | InChI=1S/C23H27NO3S/c25-22(21-13-12-19(28-21)14-17-10-11-17)24-20(15-16-6-2-1-3-7-16)23(26)27-18-8-4-5-9-18/h1-3,6-7,12-13,17-18,20H,4-5,8-11,14-15H2,(H,24,25)/t20-/m0/s1 |
| InChIKey | NYDREFIFMAOHEZ-FQEVSTJZSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |