(3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate

C17H25NO2 — CID 145335677

IUPAC(3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate
SMILESCNC(Cc1ccccc1)C(=O)OC1CCCC(C)C1
InChIInChI=1S/C17H25NO2/c1-13-7-6-10-15(11-13)20-17(19)16(18-2)12-14-8-4-3-5-9-14/h3-5,8-9,13,15-16,18H,6-7,10-12H2,1-2H3
InChIKeyCEQVMVNMBNQFIO-UHFFFAOYSA-N
MW275.39 g/mol
LogP2.94
Rot. Bonds5

About (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate

(3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate (PubChem CID 145335677) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate.

Molecular Properties

Compound Name(3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate
PubChem CID145335677
Molecular FormulaC17H25NO2
Molecular Weight275.39 g/mol
Exact Mass275.19
IUPAC Name(3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate
SMILESCNC(Cc1ccccc1)C(=O)OC1CCCC(C)C1
InChIInChI=1S/C17H25NO2/c1-13-7-6-10-15(11-13)20-17(19)16(18-2)12-14-8-4-3-5-9-14/h3-5,8-9,13,15-16,18H,6-7,10-12H2,1-2H3
InChIKeyCEQVMVNMBNQFIO-UHFFFAOYSA-N
XLogP2.94
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.39
LogP ≤ 52.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate?
The IUPAC name of (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate (CID 145335677) is (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate.
What is the SMILES notation for (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate?
The canonical SMILES for (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate is CNC(Cc1ccccc1)C(=O)OC1CCCC(C)C1.
What is the InChIKey of (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate?
The InChIKey is CEQVMVNMBNQFIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-13-7-6-10-15(11-13)20-17(19)16(18-2)12-14-8-4-3-5-9-14/h3-5,8-9,13,15-16,18H,6-7,10-12H2,1-2H3.
What are the key properties of (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate?
(3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate has a molecular weight of 275.39 g/mol, XLogP of 2.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 2-(methylamino)-3-phenylpropanoate is sourced from PubChem (CID 145335677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).