C18H26N2O3 — CID 98764146
(2R)-2-[[2-[(1S,3R)-3-methylcyclohexyl]oxyacetyl]amino]-3-phenylpropanamide (PubChem CID 98764146) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2R)-2-[[2-[(1S,3R)-3-methylcyclohexyl]oxyacetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-[(1S,3R)-3-methylcyclohexyl]oxyacetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 98764146 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2R)-2-[[2-[(1S,3R)-3-methylcyclohexyl]oxyacetyl]amino]-3-phenylpropanamide |
| SMILES | C[C@@H]1CCC[C@H](OCC(=O)N[C@H](Cc2ccccc2)C(N)=O)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-6-5-9-15(10-13)23-12-17(21)20-16(18(19)22)11-14-7-3-2-4-8-14/h2-4,7-8,13,15-16H,5-6,9-12H2,1H3,(H2,19,22)(H,20,21)/t13-,15+,16-/m1/s1 |
| InChIKey | NJFQIQJNNHOGST-VNQPRFMTSA-N |
| XLogP | 1.79 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |