(3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate

C20H30O2 — CID 90915141

IUPAC(3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate
SMILESCC1CCCC(OC(=O)C(C)CC(C)Cc2ccccc2)C1
InChIInChI=1S/C20H30O2/c1-15-8-7-11-19(14-15)22-20(21)17(3)12-16(2)13-18-9-5-4-6-10-18/h4-6,9-10,15-17,19H,7-8,11-14H2,1-3H3
InChIKeyFZLOQNJZUDKRIU-UHFFFAOYSA-N
MW302.46 g/mol
LogP5.01
Rot. Bonds6

About (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate

(3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate (PubChem CID 90915141) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate.

Molecular Properties

Compound Name(3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate
PubChem CID90915141
Molecular FormulaC20H30O2
Molecular Weight302.46 g/mol
Exact Mass302.22
IUPAC Name(3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate
SMILESCC1CCCC(OC(=O)C(C)CC(C)Cc2ccccc2)C1
InChIInChI=1S/C20H30O2/c1-15-8-7-11-19(14-15)22-20(21)17(3)12-16(2)13-18-9-5-4-6-10-18/h4-6,9-10,15-17,19H,7-8,11-14H2,1-3H3
InChIKeyFZLOQNJZUDKRIU-UHFFFAOYSA-N
XLogP5.01
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500302.46
LogP ≤ 55.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate?
The IUPAC name of (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate (CID 90915141) is (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate.
What is the SMILES notation for (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate?
The canonical SMILES for (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate is CC1CCCC(OC(=O)C(C)CC(C)Cc2ccccc2)C1.
What is the InChIKey of (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate?
The InChIKey is FZLOQNJZUDKRIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O2/c1-15-8-7-11-19(14-15)22-20(21)17(3)12-16(2)13-18-9-5-4-6-10-18/h4-6,9-10,15-17,19H,7-8,11-14H2,1-3H3.
What are the key properties of (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate?
(3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate has a molecular weight of 302.46 g/mol, XLogP of 5.01, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 2,4-dimethyl-5-phenylpentanoate is sourced from PubChem (CID 90915141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).