About (3-methylcyclohexyl) 2-phenoxyacetate
(3-methylcyclohexyl) 2-phenoxyacetate (PubChem CID 78838655) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2-phenoxyacetate.
Molecular Properties
| Compound Name | (3-methylcyclohexyl) 2-phenoxyacetate |
| PubChem CID | 78838655 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3-methylcyclohexyl) 2-phenoxyacetate |
| SMILES | CC1CCCC(OC(=O)COc2ccccc2)C1 |
| InChI | InChI=1S/C15H20O3/c1-12-6-5-9-14(10-12)18-15(16)11-17-13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11H2,1H3 |
| InChIKey | MPAKVFYBYJTREE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylcyclohexyl) 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl) 2-phenoxyacetate?
The IUPAC name of (3-methylcyclohexyl) 2-phenoxyacetate (CID 78838655) is (3-methylcyclohexyl) 2-phenoxyacetate.
What is the SMILES notation for (3-methylcyclohexyl) 2-phenoxyacetate?
The canonical SMILES for (3-methylcyclohexyl) 2-phenoxyacetate is CC1CCCC(OC(=O)COc2ccccc2)C1.
What is the InChIKey of (3-methylcyclohexyl) 2-phenoxyacetate?
The InChIKey is MPAKVFYBYJTREE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-12-6-5-9-14(10-12)18-15(16)11-17-13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11H2,1H3.
What are the key properties of (3-methylcyclohexyl) 2-phenoxyacetate?
(3-methylcyclohexyl) 2-phenoxyacetate has a molecular weight of 248.32 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 2-phenoxyacetate is sourced from PubChem (CID 78838655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).