C16H21NO2 — CID 61301735
(3-methylcyclohexyl) (2S)-2,3-dihydro-1H-indole-2-carboxylate (PubChem CID 61301735) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (3-methylcyclohexyl) (2S)-2,3-dihydro-1H-indole-2-carboxylate.
| Compound Name | (3-methylcyclohexyl) (2S)-2,3-dihydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 61301735 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (3-methylcyclohexyl) (2S)-2,3-dihydro-1H-indole-2-carboxylate |
| SMILES | CC1CCCC(OC(=O)[C@@H]2Cc3ccccc3N2)C1 |
| InChI | InChI=1S/C16H21NO2/c1-11-5-4-7-13(9-11)19-16(18)15-10-12-6-2-3-8-14(12)17-15/h2-3,6,8,11,13,15,17H,4-5,7,9-10H2,1H3/t11?,13?,15-/m0/s1 |
| InChIKey | MNSGMYMMOKLDJR-HGMXIMQMSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |