About ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride
ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride (PubChem CID 70480202) has the molecular formula C11H14Cl5NO2Sn
and a molecular weight of 488.21 g/mol. Its IUPAC name is ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride |
| PubChem CID | 70480202 |
| Molecular Formula | C11H14Cl5NO2Sn |
| Molecular Weight | 488.21 g/mol |
| Exact Mass | 486.85 |
| IUPAC Name | ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride |
| SMILES | CCOC(=O)C1Cc2ccccc2N1.Cl.Cl[Sn](Cl)(Cl)Cl |
| InChI | InChI=1S/C11H13NO2.5ClH.Sn/c1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10;;;;;;/h3-6,10,12H,2,7H2,1H3;5*1H;/q;;;;;;+4/p-4 |
| InChIKey | ZOKDPMZCYIZXIM-UHFFFAOYSA-J |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.21 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride?
The IUPAC name of ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride (CID 70480202) is ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride.
What is the SMILES notation for ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride?
The canonical SMILES for ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride is CCOC(=O)C1Cc2ccccc2N1.Cl.Cl[Sn](Cl)(Cl)Cl.
What is the InChIKey of ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride?
The InChIKey is ZOKDPMZCYIZXIM-UHFFFAOYSA-J. The full InChI is InChI=1S/C11H13NO2.5ClH.Sn/c1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10;;;;;;/h3-6,10,12H,2,7H2,1H3;5*1H;/q;;;;;;+4/p-4.
What are the key properties of ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride?
ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride has a molecular weight of 488.21 g/mol, XLogP of 4.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dihydro-1H-indole-2-carboxylate;tetrachlorostannane;hydrochloride is sourced from PubChem (CID 70480202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).