C11H13NO2Sn — CID 159251036
CID 159251036 (PubChem CID 159251036) has the molecular formula C11H13NO2Sn and a molecular weight of 309.94 g/mol.
| Compound Name | CID 159251036 |
|---|---|
| PubChem CID | 159251036 |
| Molecular Formula | C11H13NO2Sn |
| Molecular Weight | 309.94 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1Cc2ccccc2N1.[Sn] |
| InChI | InChI=1S/C11H13NO2.Sn/c1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10;/h3-6,10,12H,2,7H2,1H3; |
| InChIKey | KVHMHMWBZVMDRC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.94 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |