C14H19NO4 — CID 18637669
1,1-dihydroxypentyl (2R)-2,3-dihydro-1H-indole-2-carboxylate (PubChem CID 18637669) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1,1-dihydroxypentyl (2R)-2,3-dihydro-1H-indole-2-carboxylate.
| Compound Name | 1,1-dihydroxypentyl (2R)-2,3-dihydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 18637669 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1,1-dihydroxypentyl (2R)-2,3-dihydro-1H-indole-2-carboxylate |
| SMILES | CCCCC(O)(O)OC(=O)[C@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C14H19NO4/c1-2-3-8-14(17,18)19-13(16)12-9-10-6-4-5-7-11(10)15-12/h4-7,12,15,17-18H,2-3,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | KQACXEPHQQFXSW-GFCCVEGCSA-N |
| XLogP | 1.39 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|