C10H13NO3 — CID 174391428
2,3-dihydro-1H-indole-2-carboxylic acid;methanol (PubChem CID 174391428) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2,3-dihydro-1H-indole-2-carboxylic acid;methanol.
| Compound Name | 2,3-dihydro-1H-indole-2-carboxylic acid;methanol |
|---|---|
| PubChem CID | 174391428 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2,3-dihydro-1H-indole-2-carboxylic acid;methanol |
| SMILES | CO.O=C(O)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C9H9NO2.CH4O/c11-9(12)8-5-6-3-1-2-4-7(6)10-8;1-2/h1-4,8,10H,5H2,(H,11,12);2H,1H3 |
| InChIKey | ULUGYPVCBHEPCM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |