About 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid
2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid (PubChem CID 160725758) has the molecular formula C17H18N2O4
and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid |
| PubChem CID | 160725758 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccc(C(=O)O)c(N)c1.O=C(O)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C9H9NO2.C8H9NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8;1-5-2-3-6(8(10)11)7(9)4-5/h1-4,8,10H,5H2,(H,11,12);2-4H,9H2,1H3,(H,10,11)/t8-;/m0./s1 |
| InChIKey | RTRNBYKOVGETFR-QRPNPIFTSA-N |
| XLogP | 2.38 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid?
The IUPAC name of 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid (CID 160725758) is 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid.
What is the SMILES notation for 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid?
The canonical SMILES for 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid is Cc1ccc(C(=O)O)c(N)c1.O=C(O)[C@@H]1Cc2ccccc2N1.
What is the InChIKey of 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid?
The InChIKey is RTRNBYKOVGETFR-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H9NO2.C8H9NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8;1-5-2-3-6(8(10)11)7(9)4-5/h1-4,8,10H,5H2,(H,11,12);2-4H,9H2,1H3,(H,10,11)/t8-;/m0./s1.
What are the key properties of 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid?
2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid has a molecular weight of 314.34 g/mol, XLogP of 2.38, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methylbenzoic acid;(2S)-2,3-dihydro-1H-indole-2-carboxylic acid is sourced from PubChem (CID 160725758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).