argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid

C10H11ArNO2 — CID 158312958

IUPACargon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid
SMILESO=C(O)C1CCc2ccccc2N1.[Ar]
InChIInChI=1S/C10H11NO2.Ar/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-4,9,11H,5-6H2,(H,12,13);
InChIKeyGNXACEWZBPMNJE-UHFFFAOYSA-N
MW217.15 g/mol
LogP1.50
Rot. Bonds1

About argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid

argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 158312958) has the molecular formula C10H11ArNO2 and a molecular weight of 217.15 g/mol. Its IUPAC name is argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid.

Molecular Properties

Compound Nameargon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid
PubChem CID158312958
Molecular FormulaC10H11ArNO2
Molecular Weight217.15 g/mol
Exact Mass217.04
IUPAC Nameargon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid
SMILESO=C(O)C1CCc2ccccc2N1.[Ar]
InChIInChI=1S/C10H11NO2.Ar/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-4,9,11H,5-6H2,(H,12,13);
InChIKeyGNXACEWZBPMNJE-UHFFFAOYSA-N
XLogP1.50
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.15
LogP ≤ 51.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid?
The IUPAC name of argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid (CID 158312958) is argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
What is the SMILES notation for argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid?
The canonical SMILES for argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid is O=C(O)C1CCc2ccccc2N1.[Ar].
What is the InChIKey of argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid?
The InChIKey is GNXACEWZBPMNJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.Ar/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-4,9,11H,5-6H2,(H,12,13);.
What are the key properties of argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid?
argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid has a molecular weight of 217.15 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for argon;1,2,3,4-tetrahydroquinoline-2-carboxylic acid is sourced from PubChem (CID 158312958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).