C10H12N2O2 — CID 131146204
(2S)-5-amino-1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 131146204) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (2S)-5-amino-1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | (2S)-5-amino-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 131146204 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (2S)-5-amino-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
| SMILES | Nc1cccc2c1CC[C@@H](C(=O)O)N2 |
| InChI | InChI=1S/C10H12N2O2/c11-7-2-1-3-8-6(7)4-5-9(12-8)10(13)14/h1-3,9,12H,4-5,11H2,(H,13,14)/t9-/m0/s1 |
| InChIKey | YCTMSIGDGYEBRJ-VIFPVBQESA-N |
| XLogP | 1.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|