C10H8F3NO2 — CID 117198099
4-(trifluoromethyl)-2,3-dihydro-1H-indole-2-carboxylic acid (PubChem CID 117198099) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 4-(trifluoromethyl)-2,3-dihydro-1H-indole-2-carboxylic acid.
| Compound Name | 4-(trifluoromethyl)-2,3-dihydro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 117198099 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(trifluoromethyl)-2,3-dihydro-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2c(cccc2C(F)(F)F)N1 |
| InChI | InChI=1S/C10H8F3NO2/c11-10(12,13)6-2-1-3-7-5(6)4-8(14-7)9(15)16/h1-3,8,14H,4H2,(H,15,16) |
| InChIKey | ARCVXMOZUHAKBN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |