C16H20F3NO5 — CID 90984715
acetic acid;acetyl acetate;2-methyl-4-(trifluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 90984715) has the molecular formula C16H20F3NO5 and a molecular weight of 363.33 g/mol. Its IUPAC name is acetic acid;acetyl acetate;2-methyl-4-(trifluoromethyl)-2,3-dihydro-1H-indole.
| Compound Name | acetic acid;acetyl acetate;2-methyl-4-(trifluoromethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 90984715 |
| Molecular Formula | C16H20F3NO5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | acetic acid;acetyl acetate;2-methyl-4-(trifluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | CC(=O)O.CC(=O)OC(C)=O.CC1Cc2c(cccc2C(F)(F)F)N1 |
| InChI | InChI=1S/C10H10F3N.C4H6O3.C2H4O2/c1-6-5-7-8(10(11,12)13)3-2-4-9(7)14-6;1-3(5)7-4(2)6;1-2(3)4/h2-4,6,14H,5H2,1H3;1-2H3;1H3,(H,3,4) |
| InChIKey | LTOXMJKCUQNKBM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|