C10H11NO2 — CID 117202955
2-methyl-2,3-dihydro-1H-indole-4-carboxylic acid (PubChem CID 117202955) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1H-indole-4-carboxylic acid.
| Compound Name | 2-methyl-2,3-dihydro-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 117202955 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-methyl-2,3-dihydro-1H-indole-4-carboxylic acid |
| SMILES | CC1Cc2c(cccc2C(=O)O)N1 |
| InChI | InChI=1S/C10H11NO2/c1-6-5-8-7(10(12)13)3-2-4-9(8)11-6/h2-4,6,11H,5H2,1H3,(H,12,13) |
| InChIKey | XPVMAFPMLNHQFI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |