About (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid
(3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid (PubChem CID 130904182) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid.
Analyze (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid?
The IUPAC name of (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid (CID 130904182) is (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid.
What is the SMILES notation for (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid?
The canonical SMILES for (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid is C[C@H]1Cc2cccc(C(=O)O)c2CN1.
What is the InChIKey of (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid?
The InChIKey is SIMCWOBXDYYSSB-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H13NO2/c1-7-5-8-3-2-4-9(11(13)14)10(8)6-12-7/h2-4,7,12H,5-6H2,1H3,(H,13,14)/t7-/m0/s1.
What are the key properties of (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid?
(3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid has a molecular weight of 191.23 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methyl-1,2,3,4-tetrahydroisoquinoline-8-carboxylic acid is sourced from PubChem (CID 130904182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).