(3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid

C10H11NO2 — CID 130650466

IUPAC(3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid
SMILESC[C@@H]1NCc2cccc(C(=O)O)c21
InChIInChI=1S/C10H11NO2/c1-6-9-7(5-11-6)3-2-4-8(9)10(12)13/h2-4,6,11H,5H2,1H3,(H,12,13)/t6-/m0/s1
InChIKeyUMJWKAFSCFEGCB-LURJTMIESA-N
MW177.20 g/mol
LogP1.55
Rot. Bonds1

About (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid

(3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid (PubChem CID 130650466) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid.

Molecular Properties

Compound Name(3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid
PubChem CID130650466
Molecular FormulaC10H11NO2
Molecular Weight177.20 g/mol
Exact Mass177.08
IUPAC Name(3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid
SMILESC[C@@H]1NCc2cccc(C(=O)O)c21
InChIInChI=1S/C10H11NO2/c1-6-9-7(5-11-6)3-2-4-8(9)10(12)13/h2-4,6,11H,5H2,1H3,(H,12,13)/t6-/m0/s1
InChIKeyUMJWKAFSCFEGCB-LURJTMIESA-N
XLogP1.55
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.20
LogP ≤ 51.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid?
The IUPAC name of (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid (CID 130650466) is (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid.
What is the SMILES notation for (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid?
The canonical SMILES for (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid is C[C@@H]1NCc2cccc(C(=O)O)c21.
What is the InChIKey of (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid?
The InChIKey is UMJWKAFSCFEGCB-LURJTMIESA-N. The full InChI is InChI=1S/C10H11NO2/c1-6-9-7(5-11-6)3-2-4-8(9)10(12)13/h2-4,6,11H,5H2,1H3,(H,12,13)/t6-/m0/s1.
What are the key properties of (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid?
(3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid has a molecular weight of 177.20 g/mol, XLogP of 1.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methyl-2,3-dihydro-1H-isoindole-4-carboxylic acid is sourced from PubChem (CID 130650466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).