About 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride
2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride (PubChem CID 70040488) has the molecular formula C9H9ClO3
and a molecular weight of 200.62 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride.
Analyze 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride?
The IUPAC name of 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride (CID 70040488) is 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride.
What is the SMILES notation for 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride?
The canonical SMILES for 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride is Cl.O=C(O)c1cccc2c1OCC2.
What is the InChIKey of 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride?
The InChIKey is ZPBMTBKVPOIXDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3.ClH/c10-9(11)7-3-1-2-6-4-5-12-8(6)7;/h1-3H,4-5H2,(H,10,11);1H.
What are the key properties of 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride?
2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride has a molecular weight of 200.62 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1-benzofuran-7-carboxylic acid;hydrochloride is sourced from PubChem (CID 70040488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).