C15H11FO3 — CID 114746359
4-(2,3-dihydro-1-benzofuran-7-yl)-2-fluorobenzoic acid (PubChem CID 114746359) has the molecular formula C15H11FO3 and a molecular weight of 258.25 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-7-yl)-2-fluorobenzoic acid.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-7-yl)-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 114746359 |
| Molecular Formula | C15H11FO3 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-7-yl)-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(-c2cccc3c2OCC3)cc1F |
| InChI | InChI=1S/C15H11FO3/c16-13-8-10(4-5-12(13)15(17)18)11-3-1-2-9-6-7-19-14(9)11/h1-5,8H,6-7H2,(H,17,18) |
| InChIKey | OWJMSYCJTBXTKE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |