C15H14O — CID 23543625
7-(4-methylphenyl)-2,3-dihydro-1-benzofuran (PubChem CID 23543625) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is 7-(4-methylphenyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 7-(4-methylphenyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 23543625 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 7-(4-methylphenyl)-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc(-c2cccc3c2OCC3)cc1 |
| InChI | InChI=1S/C15H14O/c1-11-5-7-12(8-6-11)14-4-2-3-13-9-10-16-15(13)14/h2-8H,9-10H2,1H3 |
| InChIKey | BYUCJOBOMHXITG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |