C15H13ClO — CID 173176078
7-(5-chloro-2-methylphenyl)-2,3-dihydro-1-benzofuran (PubChem CID 173176078) has the molecular formula C15H13ClO and a molecular weight of 244.72 g/mol. Its IUPAC name is 7-(5-chloro-2-methylphenyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 7-(5-chloro-2-methylphenyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 173176078 |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 7-(5-chloro-2-methylphenyl)-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc(Cl)cc1-c1cccc2c1OCC2 |
| InChI | InChI=1S/C15H13ClO/c1-10-5-6-12(16)9-14(10)13-4-2-3-11-7-8-17-15(11)13/h2-6,9H,7-8H2,1H3 |
| InChIKey | QXDBHSRUWJAZEI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |