C17H14N2O — CID 145234099
8-(2,3-dihydro-1-benzofuran-7-yl)-2-methylquinazoline (PubChem CID 145234099) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 8-(2,3-dihydro-1-benzofuran-7-yl)-2-methylquinazoline.
| Compound Name | 8-(2,3-dihydro-1-benzofuran-7-yl)-2-methylquinazoline |
|---|---|
| PubChem CID | 145234099 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 8-(2,3-dihydro-1-benzofuran-7-yl)-2-methylquinazoline |
| SMILES | Cc1ncc2cccc(-c3cccc4c3OCC4)c2n1 |
| InChI | InChI=1S/C17H14N2O/c1-11-18-10-13-5-3-6-14(16(13)19-11)15-7-2-4-12-8-9-20-17(12)15/h2-7,10H,8-9H2,1H3 |
| InChIKey | VPTVFPCURWLHPF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |