C11H10N2OS — CID 114746396
5-(2,3-dihydro-1-benzofuran-7-yl)-1,3-thiazol-2-amine (PubChem CID 114746396) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-7-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-7-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114746396 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-7-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(-c2cccc3c2OCC3)s1 |
| InChI | InChI=1S/C11H10N2OS/c12-11-13-6-9(15-11)8-3-1-2-7-4-5-14-10(7)8/h1-3,6H,4-5H2,(H2,12,13) |
| InChIKey | WIPJBGAPUTWARY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |