C11H11N3O — CID 117290116
5-(2,3-dihydro-1-benzofuran-7-yl)-1H-pyrazol-3-amine (PubChem CID 117290116) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-7-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-7-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117290116 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-7-yl)-1H-pyrazol-3-amine |
| SMILES | Nc1cc(-c2cccc3c2OCC3)[nH]n1 |
| InChI | InChI=1S/C11H11N3O/c12-10-6-9(13-14-10)8-3-1-2-7-4-5-15-11(7)8/h1-3,6H,4-5H2,(H3,12,13,14) |
| InChIKey | PCPOIUMXOFTECA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |