C14H17NO — CID 114746986
3-(2,3-dihydro-1-benzofuran-7-yl)cyclohex-2-en-1-amine (PubChem CID 114746986) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-7-yl)cyclohex-2-en-1-amine.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-7-yl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 114746986 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-7-yl)cyclohex-2-en-1-amine |
| SMILES | NC1C=C(c2cccc3c2OCC3)CCC1 |
| InChI | InChI=1S/C14H17NO/c15-12-5-1-4-11(9-12)13-6-2-3-10-7-8-16-14(10)13/h2-3,6,9,12H,1,4-5,7-8,15H2 |
| InChIKey | CZRUSSFUWGVQCS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |