C12H14O2 — CID 142323380
7-cyclobutyloxy-2,3-dihydro-1-benzofuran (PubChem CID 142323380) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 7-cyclobutyloxy-2,3-dihydro-1-benzofuran.
| Compound Name | 7-cyclobutyloxy-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 142323380 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 7-cyclobutyloxy-2,3-dihydro-1-benzofuran |
| SMILES | c1cc2c(c(OC3CCC3)c1)OCC2 |
| InChI | InChI=1S/C12H14O2/c1-3-9-7-8-13-12(9)11(6-1)14-10-4-2-5-10/h1,3,6,10H,2,4-5,7-8H2 |
| InChIKey | SBOSJZYFUWDMII-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |